C18H29BrN3O5P — CID 71748303
(2S)-2-[(4-bromophenyl)carbamoylamino]-N-(diethoxyphosphorylmethyl)-4-methylpentanamide (PubChem CID 71748303) has the molecular formula C18H29BrN3O5P and a molecular weight of 478.32 g/mol. Its IUPAC name is (2S)-2-[(4-bromophenyl)carbamoylamino]-N-(diethoxyphosphorylmethyl)-4-methylpentanamide.
| Compound Name | (2S)-2-[(4-bromophenyl)carbamoylamino]-N-(diethoxyphosphorylmethyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 71748303 |
| Molecular Formula | C18H29BrN3O5P |
| Molecular Weight | 478.32 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | (2S)-2-[(4-bromophenyl)carbamoylamino]-N-(diethoxyphosphorylmethyl)-4-methylpentanamide |
| SMILES | CCOP(=O)(CNC(=O)[C@H](CC(C)C)NC(=O)Nc1ccc(Br)cc1)OCC |
| InChI | InChI=1S/C18H29BrN3O5P/c1-5-26-28(25,27-6-2)12-20-17(23)16(11-13(3)4)22-18(24)21-15-9-7-14(19)8-10-15/h7-10,13,16H,5-6,11-12H2,1-4H3,(H,20,23)(H2,21,22,24)/t16-/m0/s1 |
| InChIKey | JSBDBKWVBGKBPM-INIZCTEOSA-N |
| XLogP | 4.33 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.32 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|