About 4-cyclopropyl-1,3-thiazole-2-carbonitrile
4-cyclopropyl-1,3-thiazole-2-carbonitrile (PubChem CID 71748573) has the molecular formula C7H6N2S
and a molecular weight of 150.21 g/mol. Its IUPAC name is 4-cyclopropyl-1,3-thiazole-2-carbonitrile.
Molecular Properties
| Compound Name | 4-cyclopropyl-1,3-thiazole-2-carbonitrile |
| PubChem CID | 71748573 |
| Molecular Formula | C7H6N2S |
| Molecular Weight | 150.21 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 4-cyclopropyl-1,3-thiazole-2-carbonitrile |
| SMILES | N#Cc1nc(C2CC2)cs1 |
| InChI | InChI=1S/C7H6N2S/c8-3-7-9-6(4-10-7)5-1-2-5/h4-5H,1-2H2 |
| InChIKey | JIZTVERHEHJVJN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-cyclopropyl-1,3-thiazole-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-1,3-thiazole-2-carbonitrile?
The IUPAC name of 4-cyclopropyl-1,3-thiazole-2-carbonitrile (CID 71748573) is 4-cyclopropyl-1,3-thiazole-2-carbonitrile.
What is the SMILES notation for 4-cyclopropyl-1,3-thiazole-2-carbonitrile?
The canonical SMILES for 4-cyclopropyl-1,3-thiazole-2-carbonitrile is N#Cc1nc(C2CC2)cs1.
What is the InChIKey of 4-cyclopropyl-1,3-thiazole-2-carbonitrile?
The InChIKey is JIZTVERHEHJVJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2S/c8-3-7-9-6(4-10-7)5-1-2-5/h4-5H,1-2H2.
What are the key properties of 4-cyclopropyl-1,3-thiazole-2-carbonitrile?
4-cyclopropyl-1,3-thiazole-2-carbonitrile has a molecular weight of 150.21 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-1,3-thiazole-2-carbonitrile is sourced from PubChem (CID 71748573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).