About imidazo[1,2-a]pyridin-6-ylmethanol;hydrochloride
imidazo[1,2-a]pyridin-6-ylmethanol;hydrochloride (PubChem CID 71748611) has the molecular formula C8H9ClN2O
and a molecular weight of 184.63 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-6-ylmethanol;hydrochloride.
Molecular Properties
| Compound Name | imidazo[1,2-a]pyridin-6-ylmethanol;hydrochloride |
| PubChem CID | 71748611 |
| Molecular Formula | C8H9ClN2O |
| Molecular Weight | 184.63 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | imidazo[1,2-a]pyridin-6-ylmethanol;hydrochloride |
| SMILES | Cl.OCc1ccc2nccn2c1 |
| InChI | InChI=1S/C8H8N2O.ClH/c11-6-7-1-2-8-9-3-4-10(8)5-7;/h1-5,11H,6H2;1H |
| InChIKey | BMAAYSMVYXIDTI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.63 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze imidazo[1,2-a]pyridin-6-ylmethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,2-a]pyridin-6-ylmethanol;hydrochloride?
The IUPAC name of imidazo[1,2-a]pyridin-6-ylmethanol;hydrochloride (CID 71748611) is imidazo[1,2-a]pyridin-6-ylmethanol;hydrochloride.
What is the SMILES notation for imidazo[1,2-a]pyridin-6-ylmethanol;hydrochloride?
The canonical SMILES for imidazo[1,2-a]pyridin-6-ylmethanol;hydrochloride is Cl.OCc1ccc2nccn2c1.
What is the InChIKey of imidazo[1,2-a]pyridin-6-ylmethanol;hydrochloride?
The InChIKey is BMAAYSMVYXIDTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O.ClH/c11-6-7-1-2-8-9-3-4-10(8)5-7;/h1-5,11H,6H2;1H.
What are the key properties of imidazo[1,2-a]pyridin-6-ylmethanol;hydrochloride?
imidazo[1,2-a]pyridin-6-ylmethanol;hydrochloride has a molecular weight of 184.63 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-a]pyridin-6-ylmethanol;hydrochloride is sourced from PubChem (CID 71748611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).