C16H29NO2 — CID 71748735
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-hydroxyhexanamide (PubChem CID 71748735) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-hydroxyhexanamide.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-hydroxyhexanamide |
|---|---|
| PubChem CID | 71748735 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-6-hydroxyhexanamide |
| SMILES | CC(C)=CCC/C(C)=C/CNC(=O)CCCCCO |
| InChI | InChI=1S/C16H29NO2/c1-14(2)8-7-9-15(3)11-12-17-16(19)10-5-4-6-13-18/h8,11,18H,4-7,9-10,12-13H2,1-3H3,(H,17,19)/b15-11+ |
| InChIKey | MRCOQNUQRHPYNM-RVDMUPIBSA-N |
| XLogP | 3.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|