About N-[(2E)-3,7-dimethylocta-2,6-dienyl]hex-5-ynamide
N-[(2E)-3,7-dimethylocta-2,6-dienyl]hex-5-ynamide (PubChem CID 71748744) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]hex-5-ynamide.
Molecular Properties
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]hex-5-ynamide |
| PubChem CID | 71748744 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]hex-5-ynamide |
| SMILES | C#CCCCC(=O)NC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C16H25NO/c1-5-6-7-11-16(18)17-13-12-15(4)10-8-9-14(2)3/h1,9,12H,6-8,10-11,13H2,2-4H3,(H,17,18)/b15-12+ |
| InChIKey | OYMBSEAQGNNMTF-NTCAYCPXSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E)-3,7-dimethylocta-2,6-dienyl]hex-5-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E)-3,7-dimethylocta-2,6-dienyl]hex-5-ynamide?
The IUPAC name of N-[(2E)-3,7-dimethylocta-2,6-dienyl]hex-5-ynamide (CID 71748744) is N-[(2E)-3,7-dimethylocta-2,6-dienyl]hex-5-ynamide.
What is the SMILES notation for N-[(2E)-3,7-dimethylocta-2,6-dienyl]hex-5-ynamide?
The canonical SMILES for N-[(2E)-3,7-dimethylocta-2,6-dienyl]hex-5-ynamide is C#CCCCC(=O)NC/C=C(\C)CCC=C(C)C.
What is the InChIKey of N-[(2E)-3,7-dimethylocta-2,6-dienyl]hex-5-ynamide?
The InChIKey is OYMBSEAQGNNMTF-NTCAYCPXSA-N. The full InChI is InChI=1S/C16H25NO/c1-5-6-7-11-16(18)17-13-12-15(4)10-8-9-14(2)3/h1,9,12H,6-8,10-11,13H2,2-4H3,(H,17,18)/b15-12+.
What are the key properties of N-[(2E)-3,7-dimethylocta-2,6-dienyl]hex-5-ynamide?
N-[(2E)-3,7-dimethylocta-2,6-dienyl]hex-5-ynamide has a molecular weight of 247.38 g/mol, XLogP of 3.60, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E)-3,7-dimethylocta-2,6-dienyl]hex-5-ynamide is sourced from PubChem (CID 71748744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).