About alpha-Hydroxy-cyclohexanemethanesulfonic acid sodium salt
alpha-Hydroxy-cyclohexanemethanesulfonic acid sodium salt (PubChem CID 71748844) has the molecular formula C7H14NaO4S
and a molecular weight of 217.24 g/mol.
Molecular Properties
| Compound Name | alpha-Hydroxy-cyclohexanemethanesulfonic acid sodium salt |
| PubChem CID | 71748844 |
| Molecular Formula | C7H14NaO4S |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)C(O)C1CCCCC1.[Na] |
| InChI | InChI=1S/C7H14O4S.Na/c8-7(12(9,10)11)6-4-2-1-3-5-6;/h6-8H,1-5H2,(H,9,10,11); |
| InChIKey | KJFDHJUZCMBTLQ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze alpha-Hydroxy-cyclohexanemethanesulfonic acid sodium salt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alpha-Hydroxy-cyclohexanemethanesulfonic acid sodium salt?
The IUPAC name of alpha-Hydroxy-cyclohexanemethanesulfonic acid sodium salt (CID 71748844) is not available.
What is the SMILES notation for alpha-Hydroxy-cyclohexanemethanesulfonic acid sodium salt?
The canonical SMILES for alpha-Hydroxy-cyclohexanemethanesulfonic acid sodium salt is O=S(=O)(O)C(O)C1CCCCC1.[Na].
What is the InChIKey of alpha-Hydroxy-cyclohexanemethanesulfonic acid sodium salt?
The InChIKey is KJFDHJUZCMBTLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O4S.Na/c8-7(12(9,10)11)6-4-2-1-3-5-6;/h6-8H,1-5H2,(H,9,10,11);.
What are the key properties of alpha-Hydroxy-cyclohexanemethanesulfonic acid sodium salt?
alpha-Hydroxy-cyclohexanemethanesulfonic acid sodium salt has a molecular weight of 217.24 g/mol, XLogP of 0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for alpha-Hydroxy-cyclohexanemethanesulfonic acid sodium salt is sourced from PubChem (CID 71748844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).