C5H10N2OS — CID 71749041
1-(1,1,2,2-tetradeuterio-2-hydroxyethyl)imidazolidine-2-thione (PubChem CID 71749041) has the molecular formula C5H10N2OS and a molecular weight of 150.24 g/mol. Its IUPAC name is 1-(1,1,2,2-tetradeuterio-2-hydroxyethyl)imidazolidine-2-thione.
| Compound Name | 1-(1,1,2,2-tetradeuterio-2-hydroxyethyl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 71749041 |
| Molecular Formula | C5H10N2OS |
| Molecular Weight | 150.24 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 1-(1,1,2,2-tetradeuterio-2-hydroxyethyl)imidazolidine-2-thione |
| SMILES | [2H]C([2H])(O)C([2H])([2H])N1CCNC1=S |
| InChI | InChI=1S/C5H10N2OS/c8-4-3-7-2-1-6-5(7)9/h8H,1-4H2,(H,6,9)/i3D2,4D2 |
| InChIKey | AFEITPOSEVENMK-KHORGVISSA-N |
| XLogP | -0.83 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.24 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|