C24H26N2O8S — CID 71749246
[3-[2-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino]ethoxy]-4-methoxyphenyl] hydrogen sulfate (PubChem CID 71749246) has the molecular formula C24H26N2O8S and a molecular weight of 502.55 g/mol. Its IUPAC name is [3-[2-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino]ethoxy]-4-methoxyphenyl] hydrogen sulfate.
| Compound Name | [3-[2-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino]ethoxy]-4-methoxyphenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 71749246 |
| Molecular Formula | C24H26N2O8S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | [3-[2-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino]ethoxy]-4-methoxyphenyl] hydrogen sulfate |
| SMILES | COc1ccc(OS(=O)(=O)O)cc1OCCNCC(O)COc1cccc2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C24H26N2O8S/c1-31-21-10-9-17(34-35(28,29)30)13-23(21)32-12-11-25-14-16(27)15-33-22-8-4-7-20-24(22)18-5-2-3-6-19(18)26-20/h2-10,13,16,25-27H,11-12,14-15H2,1H3,(H,28,29,30) |
| InChIKey | YOIFXDJMLPGVMJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 139.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|