C12H6Cl6O2 — CID 71749675
(9R,11S)-3,4,5,6,13,13-hexachloro-10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridec-4-en-12-one (PubChem CID 71749675) has the molecular formula C12H6Cl6O2 and a molecular weight of 394.90 g/mol. Its IUPAC name is (9R,11S)-3,4,5,6,13,13-hexachloro-10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridec-4-en-12-one.
| Compound Name | (9R,11S)-3,4,5,6,13,13-hexachloro-10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridec-4-en-12-one |
|---|---|
| PubChem CID | 71749675 |
| Molecular Formula | C12H6Cl6O2 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 391.85 |
| IUPAC Name | (9R,11S)-3,4,5,6,13,13-hexachloro-10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridec-4-en-12-one |
| SMILES | O=C1C2C3C(C1[C@@H]1O[C@H]21)C1(Cl)C(Cl)=C(Cl)C3(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C12H6Cl6O2/c13-8-9(14)11(16)4-2-5(19)1(6-7(2)20-6)3(4)10(8,15)12(11,17)18/h1-4,6-7H/t1?,2?,3?,4?,6-,7+,10?,11? |
| InChIKey | PRGKTAHLUABTPM-IFQIWKIDSA-N |
| XLogP | 3.66 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|