C9H18Cl2N2NaO5PS2 — CID 71749874
sodium 2-[[(2R,4R)-2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-yl]sulfanyl]ethanesulfonate (PubChem CID 71749874) has the molecular formula C9H18Cl2N2NaO5PS2 and a molecular weight of 423.26 g/mol. Its IUPAC name is sodium 2-[[(2R,4R)-2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-yl]sulfanyl]ethanesulfonate.
| Compound Name | sodium 2-[[(2R,4R)-2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-yl]sulfanyl]ethanesulfonate |
|---|---|
| PubChem CID | 71749874 |
| Molecular Formula | C9H18Cl2N2NaO5PS2 |
| Molecular Weight | 423.26 g/mol |
| Exact Mass | 421.97 |
| IUPAC Name | sodium 2-[[(2R,4R)-2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-yl]sulfanyl]ethanesulfonate |
| SMILES | O=[P@]1(N(CCCl)CCCl)N[C@H](SCCS(=O)(=O)[O-])CCO1.[Na+] |
| InChI | InChI=1S/C9H19Cl2N2O5PS2.Na/c10-2-4-13(5-3-11)19(14)12-9(1-6-18-19)20-7-8-21(15,16)17;/h9H,1-8H2,(H,12,14)(H,15,16,17);/q;+1/p-1/t9-,19-;/m1./s1 |
| InChIKey | LHXWPBHSZFEANP-KCPSBDNSSA-M |
| XLogP | -1.51 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.26 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|