C34H49NO9 — CID 71750018
[(1S,4R,5S,9S,10S,11R,15R,16R,20R)-5,9,16-trihydroxy-6,18,20-trimethoxy-15-(methoxymethyl)-10,13-dimethyl-13-azahexacyclo[9.7.2.12,5.01,12.03,10.015,19]henicosan-4-yl] benzoate (PubChem CID 71750018) has the molecular formula C34H49NO9 and a molecular weight of 615.76 g/mol. Its IUPAC name is [(1S,4R,5S,9S,10S,11R,15R,16R,20R)-5,9,16-trihydroxy-6,18,20-trimethoxy-15-(methoxymethyl)-10,13-dimethyl-13-azahexacyclo[9.7.2.12,5.01,12.03,10.015,19]henicosan-4-yl] benzoate.
| Compound Name | [(1S,4R,5S,9S,10S,11R,15R,16R,20R)-5,9,16-trihydroxy-6,18,20-trimethoxy-15-(methoxymethyl)-10,13-dimethyl-13-azahexacyclo[9.7.2.12,5.01,12.03,10.015,19]henicosan-4-yl] benzoate |
|---|---|
| PubChem CID | 71750018 |
| Molecular Formula | C34H49NO9 |
| Molecular Weight | 615.76 g/mol |
| Exact Mass | 615.34 |
| IUPAC Name | [(1S,4R,5S,9S,10S,11R,15R,16R,20R)-5,9,16-trihydroxy-6,18,20-trimethoxy-15-(methoxymethyl)-10,13-dimethyl-13-azahexacyclo[9.7.2.12,5.01,12.03,10.015,19]henicosan-4-yl] benzoate |
| SMILES | COC[C@]12CN(C)C3[C@@H]4C(OC)C1[C@@]3(C(OC)C[C@H]2O)C1C[C@]2(O)C(OC)CC[C@H](O)[C@@]4(C)C1C2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H49NO9/c1-31-20(36)12-13-22(41-4)33(39)15-19(24(31)29(33)44-30(38)18-10-8-7-9-11-18)34-23(42-5)14-21(37)32(17-40-3)16-35(2)28(34)25(31)26(43-6)27(32)34/h7-11,19-29,36-37,39H,12-17H2,1-6H3/t19?,20-,21+,22?,23?,24?,25-,26?,27?,28?,29?,31-,32-,33-,34-/m0/s1 |
| InChIKey | CLNODDZVJJQWNZ-VFRXTSGDSA-N |
| XLogP | 1.74 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.76 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |