C20H22N2O4 — CID 71751155
(Z)-but-2-enedioic acid;4-phenyl-2-(trideuteriomethyl)-3,4-dihydro-1H-isoquinolin-8-amine (PubChem CID 71751155) has the molecular formula C20H22N2O4 and a molecular weight of 357.42 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;4-phenyl-2-(trideuteriomethyl)-3,4-dihydro-1H-isoquinolin-8-amine.
| Compound Name | (Z)-but-2-enedioic acid;4-phenyl-2-(trideuteriomethyl)-3,4-dihydro-1H-isoquinolin-8-amine |
|---|---|
| PubChem CID | 71751155 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (Z)-but-2-enedioic acid;4-phenyl-2-(trideuteriomethyl)-3,4-dihydro-1H-isoquinolin-8-amine |
| SMILES | O=C(O)/C=C\C(=O)O.[2H]C([2H])([2H])N1Cc2c(N)cccc2C(c2ccccc2)C1 |
| InChI | InChI=1S/C16H18N2.C4H4O4/c1-18-10-14(12-6-3-2-4-7-12)13-8-5-9-16(17)15(13)11-18;5-3(6)1-2-4(7)8/h2-9,14H,10-11,17H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/i1D3; |
| InChIKey | GEOCVSMCLVIOEV-REHQRYIOSA-N |
| XLogP | 2.56 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|