C13H14N2O2S — CID 71751382
N-[3-[2-oxo-2-(2,3,4,5,6-pentadeuteriophenyl)ethyl]-1,3-thiazolidin-2-ylidene]acetamide (PubChem CID 71751382) has the molecular formula C13H14N2O2S and a molecular weight of 267.36 g/mol. Its IUPAC name is N-[3-[2-oxo-2-(2,3,4,5,6-pentadeuteriophenyl)ethyl]-1,3-thiazolidin-2-ylidene]acetamide.
| Compound Name | N-[3-[2-oxo-2-(2,3,4,5,6-pentadeuteriophenyl)ethyl]-1,3-thiazolidin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 71751382 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | N-[3-[2-oxo-2-(2,3,4,5,6-pentadeuteriophenyl)ethyl]-1,3-thiazolidin-2-ylidene]acetamide |
| SMILES | [2H]c1c([2H])c([2H])c(C(=O)CN2CCS/C2=N\C(C)=O)c([2H])c1[2H] |
| InChI | InChI=1S/C13H14N2O2S/c1-10(16)14-13-15(7-8-18-13)9-12(17)11-5-3-2-4-6-11/h2-6H,7-9H2,1H3/b14-13-/i2D,3D,4D,5D,6D |
| InChIKey | KSMULDOXJNPNBD-MBXGJJEJSA-N |
| XLogP | 1.82 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|