About (6E,8Z)-5-oxooctadeca-6,8-dienoic acid
(6E,8Z)-5-oxooctadeca-6,8-dienoic acid (PubChem CID 71751402) has the molecular formula C18H30O3
and a molecular weight of 294.44 g/mol. Its IUPAC name is (6E,8Z)-5-oxooctadeca-6,8-dienoic acid.
Molecular Properties
| Compound Name | (6E,8Z)-5-oxooctadeca-6,8-dienoic acid |
| PubChem CID | 71751402 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (6E,8Z)-5-oxooctadeca-6,8-dienoic acid |
| SMILES | CCCCCCCCC/C=C\C=C\C(=O)CCCC(=O)O |
| InChI | InChI=1S/C18H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-14-17(19)15-13-16-18(20)21/h10-12,14H,2-9,13,15-16H2,1H3,(H,20,21)/b11-10-,14-12+ |
| InChIKey | YVWMHFYOIJMUMN-HSINTONASA-N |
| XLogP | 5.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (6E,8Z)-5-oxooctadeca-6,8-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E,8Z)-5-oxooctadeca-6,8-dienoic acid?
The IUPAC name of (6E,8Z)-5-oxooctadeca-6,8-dienoic acid (CID 71751402) is (6E,8Z)-5-oxooctadeca-6,8-dienoic acid.
What is the SMILES notation for (6E,8Z)-5-oxooctadeca-6,8-dienoic acid?
The canonical SMILES for (6E,8Z)-5-oxooctadeca-6,8-dienoic acid is CCCCCCCCC/C=C\C=C\C(=O)CCCC(=O)O.
What is the InChIKey of (6E,8Z)-5-oxooctadeca-6,8-dienoic acid?
The InChIKey is YVWMHFYOIJMUMN-HSINTONASA-N. The full InChI is InChI=1S/C18H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-14-17(19)15-13-16-18(20)21/h10-12,14H,2-9,13,15-16H2,1H3,(H,20,21)/b11-10-,14-12+.
What are the key properties of (6E,8Z)-5-oxooctadeca-6,8-dienoic acid?
(6E,8Z)-5-oxooctadeca-6,8-dienoic acid has a molecular weight of 294.44 g/mol, XLogP of 5.06, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6E,8Z)-5-oxooctadeca-6,8-dienoic acid is sourced from PubChem (CID 71751402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).