About (3R)-3-hydroxy-4,4-bis(trideuteriomethyl)oxolan-2-one
(3R)-3-hydroxy-4,4-bis(trideuteriomethyl)oxolan-2-one (PubChem CID 71751460) has the molecular formula C6H10O3
and a molecular weight of 136.18 g/mol. Its IUPAC name is (3R)-3-hydroxy-4,4-bis(trideuteriomethyl)oxolan-2-one.
Molecular Properties
| Compound Name | (3R)-3-hydroxy-4,4-bis(trideuteriomethyl)oxolan-2-one |
| PubChem CID | 71751460 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 136.18 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (3R)-3-hydroxy-4,4-bis(trideuteriomethyl)oxolan-2-one |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])COC(=O)[C@@H]1O |
| InChI | InChI=1S/C6H10O3/c1-6(2)3-9-5(8)4(6)7/h4,7H,3H2,1-2H3/t4-/m0/s1/i1D3,2D3 |
| InChIKey | SERHXTVXHNVDKA-JJCAPIKSSA-N |
| XLogP | -0.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.18 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3-hydroxy-4,4-bis(trideuteriomethyl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-hydroxy-4,4-bis(trideuteriomethyl)oxolan-2-one?
The IUPAC name of (3R)-3-hydroxy-4,4-bis(trideuteriomethyl)oxolan-2-one (CID 71751460) is (3R)-3-hydroxy-4,4-bis(trideuteriomethyl)oxolan-2-one.
What is the SMILES notation for (3R)-3-hydroxy-4,4-bis(trideuteriomethyl)oxolan-2-one?
The canonical SMILES for (3R)-3-hydroxy-4,4-bis(trideuteriomethyl)oxolan-2-one is [2H]C([2H])([2H])C1(C([2H])([2H])[2H])COC(=O)[C@@H]1O.
What is the InChIKey of (3R)-3-hydroxy-4,4-bis(trideuteriomethyl)oxolan-2-one?
The InChIKey is SERHXTVXHNVDKA-JJCAPIKSSA-N. The full InChI is InChI=1S/C6H10O3/c1-6(2)3-9-5(8)4(6)7/h4,7H,3H2,1-2H3/t4-/m0/s1/i1D3,2D3.
What are the key properties of (3R)-3-hydroxy-4,4-bis(trideuteriomethyl)oxolan-2-one?
(3R)-3-hydroxy-4,4-bis(trideuteriomethyl)oxolan-2-one has a molecular weight of 136.18 g/mol, XLogP of -0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-hydroxy-4,4-bis(trideuteriomethyl)oxolan-2-one is sourced from PubChem (CID 71751460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).