C27H34N4O — CID 71751696
1-(3-cyano-3,3-diphenylpropyl)-4-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)piperidine-4-carboxamide (PubChem CID 71751696) has the molecular formula C27H34N4O and a molecular weight of 440.66 g/mol. Its IUPAC name is 1-(3-cyano-3,3-diphenylpropyl)-4-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)piperidine-4-carboxamide.
| Compound Name | 1-(3-cyano-3,3-diphenylpropyl)-4-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 71751696 |
| Molecular Formula | C27H34N4O |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 440.34 |
| IUPAC Name | 1-(3-cyano-3,3-diphenylpropyl)-4-(2,2,3,3,4,4,5,5,6,6-decadeuteriopiperidin-1-yl)piperidine-4-carboxamide |
| SMILES | [2H]C1([2H])N(C2(C(N)=O)CCN(CCC(C#N)(c3ccccc3)c3ccccc3)CC2)C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C27H34N4O/c28-22-26(23-10-4-1-5-11-23,24-12-6-2-7-13-24)14-19-30-20-15-27(16-21-30,25(29)32)31-17-8-3-9-18-31/h1-2,4-7,10-13H,3,8-9,14-21H2,(H2,29,32)/i3D2,8D2,9D2,17D2,18D2 |
| InChIKey | IHEHEFLXQFOQJO-BQJHTADZSA-N |
| XLogP | 3.69 |
| TPSA | 73.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |