About (6-oxo-5H-benzo[b][1,4]benzoxazepin-10-yl) hydrogen sulfate
(6-oxo-5H-benzo[b][1,4]benzoxazepin-10-yl) hydrogen sulfate (PubChem CID 71752256) has the molecular formula C13H9NO6S
and a molecular weight of 307.28 g/mol. Its IUPAC name is (6-oxo-5H-benzo[b][1,4]benzoxazepin-10-yl) hydrogen sulfate.
Molecular Properties
| Compound Name | (6-oxo-5H-benzo[b][1,4]benzoxazepin-10-yl) hydrogen sulfate |
| PubChem CID | 71752256 |
| Molecular Formula | C13H9NO6S |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | (6-oxo-5H-benzo[b][1,4]benzoxazepin-10-yl) hydrogen sulfate |
| SMILES | O=C1Nc2ccccc2Oc2c(OS(=O)(=O)O)cccc21 |
| InChI | InChI=1S/C13H9NO6S/c15-13-8-4-3-7-11(20-21(16,17)18)12(8)19-10-6-2-1-5-9(10)14-13/h1-7H,(H,14,15)(H,16,17,18) |
| InChIKey | BQDIANYAWKOFHE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (6-oxo-5H-benzo[b][1,4]benzoxazepin-10-yl) hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-oxo-5H-benzo[b][1,4]benzoxazepin-10-yl) hydrogen sulfate?
The IUPAC name of (6-oxo-5H-benzo[b][1,4]benzoxazepin-10-yl) hydrogen sulfate (CID 71752256) is (6-oxo-5H-benzo[b][1,4]benzoxazepin-10-yl) hydrogen sulfate.
What is the SMILES notation for (6-oxo-5H-benzo[b][1,4]benzoxazepin-10-yl) hydrogen sulfate?
The canonical SMILES for (6-oxo-5H-benzo[b][1,4]benzoxazepin-10-yl) hydrogen sulfate is O=C1Nc2ccccc2Oc2c(OS(=O)(=O)O)cccc21.
What is the InChIKey of (6-oxo-5H-benzo[b][1,4]benzoxazepin-10-yl) hydrogen sulfate?
The InChIKey is BQDIANYAWKOFHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO6S/c15-13-8-4-3-7-11(20-21(16,17)18)12(8)19-10-6-2-1-5-9(10)14-13/h1-7H,(H,14,15)(H,16,17,18).
What are the key properties of (6-oxo-5H-benzo[b][1,4]benzoxazepin-10-yl) hydrogen sulfate?
(6-oxo-5H-benzo[b][1,4]benzoxazepin-10-yl) hydrogen sulfate has a molecular weight of 307.28 g/mol, XLogP of 2.23, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-oxo-5H-benzo[b][1,4]benzoxazepin-10-yl) hydrogen sulfate is sourced from PubChem (CID 71752256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).