C18H38BrN3O2 — CID 71752724
[6-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-6-oxohexyl]-trimethylazanium bromide (PubChem CID 71752724) has the molecular formula C18H38BrN3O2 and a molecular weight of 408.43 g/mol. Its IUPAC name is [6-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-6-oxohexyl]-trimethylazanium bromide.
| Compound Name | [6-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-6-oxohexyl]-trimethylazanium bromide |
|---|---|
| PubChem CID | 71752724 |
| Molecular Formula | C18H38BrN3O2 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | [6-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-6-oxohexyl]-trimethylazanium bromide |
| SMILES | CC1(C)CC(NC(=O)CCCCC[N+](C)(C)C)CC(C)(C)N1O.[Br-] |
| InChI | InChI=1S/C18H37N3O2.BrH/c1-17(2)13-15(14-18(3,4)20(17)23)19-16(22)11-9-8-10-12-21(5,6)7;/h15,23H,8-14H2,1-7H3;1H |
| InChIKey | NYPKAICVAHEAJW-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|