C16H17F3N2O6 — CID 71752748
dimethyl (2S)-2-[[2,3,5,6-tetradeuterio-4-[(2,2,2-trifluoroacetyl)amino]benzoyl]amino]pentanedioate (PubChem CID 71752748) has the molecular formula C16H17F3N2O6 and a molecular weight of 394.34 g/mol. Its IUPAC name is dimethyl (2S)-2-[[2,3,5,6-tetradeuterio-4-[(2,2,2-trifluoroacetyl)amino]benzoyl]amino]pentanedioate.
| Compound Name | dimethyl (2S)-2-[[2,3,5,6-tetradeuterio-4-[(2,2,2-trifluoroacetyl)amino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 71752748 |
| Molecular Formula | C16H17F3N2O6 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | dimethyl (2S)-2-[[2,3,5,6-tetradeuterio-4-[(2,2,2-trifluoroacetyl)amino]benzoyl]amino]pentanedioate |
| SMILES | [2H]c1c([2H])c(C(=O)N[C@@H](CCC(=O)OC)C(=O)OC)c([2H])c([2H])c1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C16H17F3N2O6/c1-26-12(22)8-7-11(14(24)27-2)21-13(23)9-3-5-10(6-4-9)20-15(25)16(17,18)19/h3-6,11H,7-8H2,1-2H3,(H,20,25)(H,21,23)/t11-/m0/s1/i3D,4D,5D,6D |
| InChIKey | RXRWKOBMLFNNBA-BECXPWMJSA-N |
| XLogP | 1.41 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |