C19H30Si — CID 71752832
trimethyl-[(3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-3,5-dien-1-ynyl]silane (PubChem CID 71752832) has the molecular formula C19H30Si and a molecular weight of 286.54 g/mol. Its IUPAC name is trimethyl-[(3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-3,5-dien-1-ynyl]silane.
| Compound Name | trimethyl-[(3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-3,5-dien-1-ynyl]silane |
|---|---|
| PubChem CID | 71752832 |
| Molecular Formula | C19H30Si |
| Molecular Weight | 286.54 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | trimethyl-[(3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-3,5-dien-1-ynyl]silane |
| SMILES | CC1=C(/C=C/C(C)=C/C#C[Si](C)(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C19H30Si/c1-16(10-9-15-20(5,6)7)12-13-18-17(2)11-8-14-19(18,3)4/h10,12-13H,8,11,14H2,1-7H3/b13-12+,16-10+ |
| InChIKey | ZJGZJNHUUDMYPM-XTQLBDSXSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.54 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|