C13H19NO3 — CID 71752946
(2S)-2-[[2-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]methyl]morpholine (PubChem CID 71752946) has the molecular formula C13H19NO3 and a molecular weight of 242.33 g/mol. Its IUPAC name is (2S)-2-[[2-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]methyl]morpholine.
| Compound Name | (2S)-2-[[2-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]methyl]morpholine |
|---|---|
| PubChem CID | 71752946 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (2S)-2-[[2-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]methyl]morpholine |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])Oc1ccccc1OC[C@@H]1CNCCO1 |
| InChI | InChI=1S/C13H19NO3/c1-2-15-12-5-3-4-6-13(12)17-10-11-9-14-7-8-16-11/h3-6,11,14H,2,7-10H2,1H3/t11-/m0/s1/i1D3,2D2 |
| InChIKey | YWPHCCPCQOJSGZ-KWTQIMNASA-N |
| XLogP | 1.45 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |