C26H28O7 — CID 71753692
(4S,12E)-20-(furan-2-yl)-22-methoxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 71753692) has the molecular formula C26H28O7 and a molecular weight of 452.50 g/mol. Its IUPAC name is (4S,12E)-20-(furan-2-yl)-22-methoxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | (4S,12E)-20-(furan-2-yl)-22-methoxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 71753692 |
| Molecular Formula | C26H28O7 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | (4S,12E)-20-(furan-2-yl)-22-methoxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | COc1c2c(cc3c1C(c1ccco1)CC(=O)O3)/C=C/CCCC(=O)CCC[C@H](C)OC2=O |
| InChI | InChI=1S/C26H28O7/c1-16-8-6-11-18(27)10-5-3-4-9-17-14-21-24(25(30-2)23(17)26(29)32-16)19(15-22(28)33-21)20-12-7-13-31-20/h4,7,9,12-14,16,19H,3,5-6,8,10-11,15H2,1-2H3/b9-4+/t16-,19?/m0/s1 |
| InChIKey | HDNRNUXKLQQPKY-GXFULXNDSA-N |
| XLogP | 5.21 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|