C23H17NO6 — CID 71753904
ethyl 4-oxo-3-(2-oxo-1H-quinolin-3-yl)-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate (PubChem CID 71753904) has the molecular formula C23H17NO6 and a molecular weight of 403.39 g/mol. Its IUPAC name is ethyl 4-oxo-3-(2-oxo-1H-quinolin-3-yl)-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate.
| Compound Name | ethyl 4-oxo-3-(2-oxo-1H-quinolin-3-yl)-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 71753904 |
| Molecular Formula | C23H17NO6 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | ethyl 4-oxo-3-(2-oxo-1H-quinolin-3-yl)-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate |
| SMILES | CCOC(=O)C1Oc2c(c(=O)oc3ccccc23)C1c1cc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C23H17NO6/c1-2-28-23(27)20-17(14-11-12-7-3-5-9-15(12)24-21(14)25)18-19(30-20)13-8-4-6-10-16(13)29-22(18)26/h3-11,17,20H,2H2,1H3,(H,24,25) |
| InChIKey | TZGXCSXIGQOZOY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|