C23H33N3O2 — CID 71753943
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-[1-(2-methoxyethyl)indol-3-yl]acetamide (PubChem CID 71753943) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-[1-(2-methoxyethyl)indol-3-yl]acetamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-[1-(2-methoxyethyl)indol-3-yl]acetamide |
|---|---|
| PubChem CID | 71753943 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-[1-(2-methoxyethyl)indol-3-yl]acetamide |
| SMILES | COCCn1cc(CC(=O)NC[C@@H]2CCCN3CCCC[C@H]23)c2ccccc21 |
| InChI | InChI=1S/C23H33N3O2/c1-28-14-13-26-17-19(20-8-2-3-10-22(20)26)15-23(27)24-16-18-7-6-12-25-11-5-4-9-21(18)25/h2-3,8,10,17-18,21H,4-7,9,11-16H2,1H3,(H,24,27)/t18-,21+/m0/s1 |
| InChIKey | UXSANNAFYIKTLF-GHTZIAJQSA-N |
| XLogP | 3.21 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |