C19H23ClN2OS — CID 71753990
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4-chloro-1-benzothiophene-2-carboxamide (PubChem CID 71753990) has the molecular formula C19H23ClN2OS and a molecular weight of 362.93 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 71753990 |
| Molecular Formula | C19H23ClN2OS |
| Molecular Weight | 362.93 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4-chloro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCN2CCCC[C@H]12)c1cc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C19H23ClN2OS/c20-15-6-3-8-17-14(15)11-18(24-17)19(23)21-12-13-5-4-10-22-9-2-1-7-16(13)22/h3,6,8,11,13,16H,1-2,4-5,7,9-10,12H2,(H,21,23)/t13-,16+/m0/s1 |
| InChIKey | MEIZQZZEDORMJF-XJKSGUPXSA-N |
| XLogP | 4.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.93 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |