C25H37N3O — CID 71754330
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4-(1-propan-2-ylindol-3-yl)butanamide (PubChem CID 71754330) has the molecular formula C25H37N3O and a molecular weight of 395.59 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4-(1-propan-2-ylindol-3-yl)butanamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4-(1-propan-2-ylindol-3-yl)butanamide |
|---|---|
| PubChem CID | 71754330 |
| Molecular Formula | C25H37N3O |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.29 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4-(1-propan-2-ylindol-3-yl)butanamide |
| SMILES | CC(C)n1cc(CCCC(=O)NC[C@@H]2CCCN3CCCC[C@H]23)c2ccccc21 |
| InChI | InChI=1S/C25H37N3O/c1-19(2)28-18-21(22-11-3-4-13-24(22)28)9-7-14-25(29)26-17-20-10-8-16-27-15-6-5-12-23(20)27/h3-4,11,13,18-20,23H,5-10,12,14-17H2,1-2H3,(H,26,29)/t20-,23+/m0/s1 |
| InChIKey | GNZVPDSPCKPLRR-NZQKXSOJSA-N |
| XLogP | 4.93 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |