C24H17NO6 — CID 71755066
5-hydroxy-3-(4-methoxyphenyl)-10-pyridin-3-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 71755066) has the molecular formula C24H17NO6 and a molecular weight of 415.40 g/mol. Its IUPAC name is 5-hydroxy-3-(4-methoxyphenyl)-10-pyridin-3-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 5-hydroxy-3-(4-methoxyphenyl)-10-pyridin-3-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 71755066 |
| Molecular Formula | C24H17NO6 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 5-hydroxy-3-(4-methoxyphenyl)-10-pyridin-3-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc(-c2coc3c4c(cc(O)c3c2=O)OC(=O)CC4c2cccnc2)cc1 |
| InChI | InChI=1S/C24H17NO6/c1-29-15-6-4-13(5-7-15)17-12-30-24-21-16(14-3-2-8-25-11-14)9-20(27)31-19(21)10-18(26)22(24)23(17)28/h2-8,10-12,16,26H,9H2,1H3 |
| InChIKey | XAPNQHXBPMKFHR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|