About 3-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]propanoic acid
3-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]propanoic acid (PubChem CID 71755379) has the molecular formula C8H12N2O4
and a molecular weight of 200.19 g/mol. Its IUPAC name is 3-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]propanoic acid.
Analyze 3-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]propanoic acid?
The IUPAC name of 3-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]propanoic acid (CID 71755379) is 3-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]propanoic acid.
What is the SMILES notation for 3-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]propanoic acid?
The canonical SMILES for 3-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]propanoic acid is COC(C)c1noc(CCC(=O)O)n1.
What is the InChIKey of 3-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]propanoic acid?
The InChIKey is HYBUIASIUHVEPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4/c1-5(13-2)8-9-6(14-10-8)3-4-7(11)12/h5H,3-4H2,1-2H3,(H,11,12).
What are the key properties of 3-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]propanoic acid?
3-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]propanoic acid has a molecular weight of 200.19 g/mol, XLogP of 0.79, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(1-methoxyethyl)-1,2,4-oxadiazol-5-yl]propanoic acid is sourced from PubChem (CID 71755379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).