(1S,5R)-9-oxo-3-thiabicyclo[3.3.1]nonane-7-carboxylic acid

C9H12O3S — CID 71755417

IUPAC(1S,5R)-9-oxo-3-thiabicyclo[3.3.1]nonane-7-carboxylic acid
SMILESO=C(O)C1C[C@H]2CSC[C@@H](C1)C2=O
InChIInChI=1S/C9H12O3S/c10-8-6-1-5(9(11)12)2-7(8)4-13-3-6/h5-7H,1-4H2,(H,11,12)/t5?,6-,7+
InChIKeyBIABQGBXOGNDRV-DGUCWDHESA-N
MW200.26 g/mol
LogP1.03
Rot. Bonds1

About (1S,5R)-9-oxo-3-thiabicyclo[3.3.1]nonane-7-carboxylic acid

(1S,5R)-9-oxo-3-thiabicyclo[3.3.1]nonane-7-carboxylic acid (PubChem CID 71755417) has the molecular formula C9H12O3S and a molecular weight of 200.26 g/mol. Its IUPAC name is (1S,5R)-9-oxo-3-thiabicyclo[3.3.1]nonane-7-carboxylic acid.

Molecular Properties

Compound Name(1S,5R)-9-oxo-3-thiabicyclo[3.3.1]nonane-7-carboxylic acid
PubChem CID71755417
Molecular FormulaC9H12O3S
Molecular Weight200.26 g/mol
Exact Mass200.05
IUPAC Name(1S,5R)-9-oxo-3-thiabicyclo[3.3.1]nonane-7-carboxylic acid
SMILESO=C(O)C1C[C@H]2CSC[C@@H](C1)C2=O
InChIInChI=1S/C9H12O3S/c10-8-6-1-5(9(11)12)2-7(8)4-13-3-6/h5-7H,1-4H2,(H,11,12)/t5?,6-,7+
InChIKeyBIABQGBXOGNDRV-DGUCWDHESA-N
XLogP1.03
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.26
LogP ≤ 51.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (1S,5R)-9-oxo-3-thiabicyclo[3.3.1]nonane-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1S,5R)-9-oxo-3-thiabicyclo[3.3.1]nonane-7-carboxylic acid?
The IUPAC name of (1S,5R)-9-oxo-3-thiabicyclo[3.3.1]nonane-7-carboxylic acid (CID 71755417) is (1S,5R)-9-oxo-3-thiabicyclo[3.3.1]nonane-7-carboxylic acid.
What is the SMILES notation for (1S,5R)-9-oxo-3-thiabicyclo[3.3.1]nonane-7-carboxylic acid?
The canonical SMILES for (1S,5R)-9-oxo-3-thiabicyclo[3.3.1]nonane-7-carboxylic acid is O=C(O)C1C[C@H]2CSC[C@@H](C1)C2=O.
What is the InChIKey of (1S,5R)-9-oxo-3-thiabicyclo[3.3.1]nonane-7-carboxylic acid?
The InChIKey is BIABQGBXOGNDRV-DGUCWDHESA-N. The full InChI is InChI=1S/C9H12O3S/c10-8-6-1-5(9(11)12)2-7(8)4-13-3-6/h5-7H,1-4H2,(H,11,12)/t5?,6-,7+.
What are the key properties of (1S,5R)-9-oxo-3-thiabicyclo[3.3.1]nonane-7-carboxylic acid?
(1S,5R)-9-oxo-3-thiabicyclo[3.3.1]nonane-7-carboxylic acid has a molecular weight of 200.26 g/mol, XLogP of 1.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-9-oxo-3-thiabicyclo[3.3.1]nonane-7-carboxylic acid is sourced from PubChem (CID 71755417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).