About 1-cyclopropyl-1,4-diazepan-5-one
1-cyclopropyl-1,4-diazepan-5-one (PubChem CID 71755456) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 1-cyclopropyl-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 1-cyclopropyl-1,4-diazepan-5-one |
| PubChem CID | 71755456 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 1-cyclopropyl-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C2CC2)CCN1 |
| InChI | InChI=1S/C8H14N2O/c11-8-3-5-10(6-4-9-8)7-1-2-7/h7H,1-6H2,(H,9,11) |
| InChIKey | SERFALWWEPVOSQ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopropyl-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-1,4-diazepan-5-one?
The IUPAC name of 1-cyclopropyl-1,4-diazepan-5-one (CID 71755456) is 1-cyclopropyl-1,4-diazepan-5-one.
What is the SMILES notation for 1-cyclopropyl-1,4-diazepan-5-one?
The canonical SMILES for 1-cyclopropyl-1,4-diazepan-5-one is O=C1CCN(C2CC2)CCN1.
What is the InChIKey of 1-cyclopropyl-1,4-diazepan-5-one?
The InChIKey is SERFALWWEPVOSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c11-8-3-5-10(6-4-9-8)7-1-2-7/h7H,1-6H2,(H,9,11).
What are the key properties of 1-cyclopropyl-1,4-diazepan-5-one?
1-cyclopropyl-1,4-diazepan-5-one has a molecular weight of 154.21 g/mol, XLogP of -0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-1,4-diazepan-5-one is sourced from PubChem (CID 71755456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).