About 2-hydrazinylpropan-1-ol;dihydrochloride
2-hydrazinylpropan-1-ol;dihydrochloride (PubChem CID 71755463) has the molecular formula C3H12Cl2N2O
and a molecular weight of 163.05 g/mol. Its IUPAC name is 2-hydrazinylpropan-1-ol;dihydrochloride.
Molecular Properties
| Compound Name | 2-hydrazinylpropan-1-ol;dihydrochloride |
| PubChem CID | 71755463 |
| Molecular Formula | C3H12Cl2N2O |
| Molecular Weight | 163.05 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | 2-hydrazinylpropan-1-ol;dihydrochloride |
| SMILES | CC(CO)NN.Cl.Cl |
| InChI | InChI=1S/C3H10N2O.2ClH/c1-3(2-6)5-4;;/h3,5-6H,2,4H2,1H3;2*1H |
| InChIKey | GGTBIYOXROJPHM-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.05 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydrazinylpropan-1-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydrazinylpropan-1-ol;dihydrochloride?
The IUPAC name of 2-hydrazinylpropan-1-ol;dihydrochloride (CID 71755463) is 2-hydrazinylpropan-1-ol;dihydrochloride.
What is the SMILES notation for 2-hydrazinylpropan-1-ol;dihydrochloride?
The canonical SMILES for 2-hydrazinylpropan-1-ol;dihydrochloride is CC(CO)NN.Cl.Cl.
What is the InChIKey of 2-hydrazinylpropan-1-ol;dihydrochloride?
The InChIKey is GGTBIYOXROJPHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10N2O.2ClH/c1-3(2-6)5-4;;/h3,5-6H,2,4H2,1H3;2*1H.
What are the key properties of 2-hydrazinylpropan-1-ol;dihydrochloride?
2-hydrazinylpropan-1-ol;dihydrochloride has a molecular weight of 163.05 g/mol, XLogP of -0.33, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydrazinylpropan-1-ol;dihydrochloride is sourced from PubChem (CID 71755463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).