About 1-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-N-methylmethanamine
1-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-N-methylmethanamine (PubChem CID 71755475) has the molecular formula C8H14N2OS
and a molecular weight of 186.28 g/mol. Its IUPAC name is 1-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-N-methylmethanamine |
| PubChem CID | 71755475 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 1-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-N-methylmethanamine |
| SMILES | CNCc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C8H14N2OS/c1-6(11-3)8-10-7(4-9-2)5-12-8/h5-6,9H,4H2,1-3H3 |
| InChIKey | GBSCXERTQSCIIL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-N-methylmethanamine?
The IUPAC name of 1-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-N-methylmethanamine (CID 71755475) is 1-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-N-methylmethanamine.
What is the SMILES notation for 1-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-N-methylmethanamine?
The canonical SMILES for 1-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-N-methylmethanamine is CNCc1csc(C(C)OC)n1.
What is the InChIKey of 1-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-N-methylmethanamine?
The InChIKey is GBSCXERTQSCIIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2OS/c1-6(11-3)8-10-7(4-9-2)5-12-8/h5-6,9H,4H2,1-3H3.
What are the key properties of 1-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-N-methylmethanamine?
1-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-N-methylmethanamine has a molecular weight of 186.28 g/mol, XLogP of 1.57, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1-methoxyethyl)-1,3-thiazol-4-yl]-N-methylmethanamine is sourced from PubChem (CID 71755475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).