About 3-ethoxy-2,2-diethyl-N-methylcyclobutan-1-amine;hydrochloride
3-ethoxy-2,2-diethyl-N-methylcyclobutan-1-amine;hydrochloride (PubChem CID 71755574) has the molecular formula C11H24ClNO
and a molecular weight of 221.77 g/mol. Its IUPAC name is 3-ethoxy-2,2-diethyl-N-methylcyclobutan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-ethoxy-2,2-diethyl-N-methylcyclobutan-1-amine;hydrochloride |
| PubChem CID | 71755574 |
| Molecular Formula | C11H24ClNO |
| Molecular Weight | 221.77 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 3-ethoxy-2,2-diethyl-N-methylcyclobutan-1-amine;hydrochloride |
| SMILES | CCOC1CC(NC)C1(CC)CC.Cl |
| InChI | InChI=1S/C11H23NO.ClH/c1-5-11(6-2)9(12-4)8-10(11)13-7-3;/h9-10,12H,5-8H2,1-4H3;1H |
| InChIKey | JKIRMFRWTCKVQZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.77 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethoxy-2,2-diethyl-N-methylcyclobutan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2,2-diethyl-N-methylcyclobutan-1-amine;hydrochloride?
The IUPAC name of 3-ethoxy-2,2-diethyl-N-methylcyclobutan-1-amine;hydrochloride (CID 71755574) is 3-ethoxy-2,2-diethyl-N-methylcyclobutan-1-amine;hydrochloride.
What is the SMILES notation for 3-ethoxy-2,2-diethyl-N-methylcyclobutan-1-amine;hydrochloride?
The canonical SMILES for 3-ethoxy-2,2-diethyl-N-methylcyclobutan-1-amine;hydrochloride is CCOC1CC(NC)C1(CC)CC.Cl.
What is the InChIKey of 3-ethoxy-2,2-diethyl-N-methylcyclobutan-1-amine;hydrochloride?
The InChIKey is JKIRMFRWTCKVQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO.ClH/c1-5-11(6-2)9(12-4)8-10(11)13-7-3;/h9-10,12H,5-8H2,1-4H3;1H.
What are the key properties of 3-ethoxy-2,2-diethyl-N-methylcyclobutan-1-amine;hydrochloride?
3-ethoxy-2,2-diethyl-N-methylcyclobutan-1-amine;hydrochloride has a molecular weight of 221.77 g/mol, XLogP of 2.61, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2,2-diethyl-N-methylcyclobutan-1-amine;hydrochloride is sourced from PubChem (CID 71755574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).