C8H11N3 — CID 71755787
7-methyl-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine (PubChem CID 71755787) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 7-methyl-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine.
| Compound Name | 7-methyl-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 71755787 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 7-methyl-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine |
| SMILES | Cc1cnc2c(c1)NCCN2 |
| InChI | InChI=1S/C8H11N3/c1-6-4-7-8(11-5-6)10-3-2-9-7/h4-5,9H,2-3H2,1H3,(H,10,11) |
| InChIKey | WGQVPTWRKMXGON-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |