C10H11NO2S2 — CID 71755810
2,7-dimethyl-1-benzothiophene-3-sulfonamide (PubChem CID 71755810) has the molecular formula C10H11NO2S2 and a molecular weight of 241.34 g/mol. Its IUPAC name is 2,7-dimethyl-1-benzothiophene-3-sulfonamide.
| Compound Name | 2,7-dimethyl-1-benzothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 71755810 |
| Molecular Formula | C10H11NO2S2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 2,7-dimethyl-1-benzothiophene-3-sulfonamide |
| SMILES | Cc1sc2c(C)cccc2c1S(N)(=O)=O |
| InChI | InChI=1S/C10H11NO2S2/c1-6-4-3-5-8-9(6)14-7(2)10(8)15(11,12)13/h3-5H,1-2H3,(H2,11,12,13) |
| InChIKey | SCDNNKCTHYKEGH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |