C15H14NNaO2S — CID 71755869
sodium 2-(6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetate (PubChem CID 71755869) has the molecular formula C15H14NNaO2S and a molecular weight of 295.34 g/mol. Its IUPAC name is sodium 2-(6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetate.
| Compound Name | sodium 2-(6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetate |
|---|---|
| PubChem CID | 71755869 |
| Molecular Formula | C15H14NNaO2S |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | sodium 2-(6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetate |
| SMILES | O=C([O-])Cc1nc2c(s1)CC(c1ccccc1)CC2.[Na+] |
| InChI | InChI=1S/C15H15NO2S.Na/c17-15(18)9-14-16-12-7-6-11(8-13(12)19-14)10-4-2-1-3-5-10;/h1-5,11H,6-9H2,(H,17,18);/q;+1/p-1 |
| InChIKey | FCYVVNFYESGMQM-UHFFFAOYSA-M |
| XLogP | -1.29 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |