About 2-(5-chloro-1,3-benzothiazol-2-yl)ethanamine;hydrochloride
2-(5-chloro-1,3-benzothiazol-2-yl)ethanamine;hydrochloride (PubChem CID 71755889) has the molecular formula C9H10Cl2N2S
and a molecular weight of 249.17 g/mol. Its IUPAC name is 2-(5-chloro-1,3-benzothiazol-2-yl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(5-chloro-1,3-benzothiazol-2-yl)ethanamine;hydrochloride |
| PubChem CID | 71755889 |
| Molecular Formula | C9H10Cl2N2S |
| Molecular Weight | 249.17 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 2-(5-chloro-1,3-benzothiazol-2-yl)ethanamine;hydrochloride |
| SMILES | Cl.NCCc1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C9H9ClN2S.ClH/c10-6-1-2-8-7(5-6)12-9(13-8)3-4-11;/h1-2,5H,3-4,11H2;1H |
| InChIKey | JJPBWCIHXKXTKF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.17 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-chloro-1,3-benzothiazol-2-yl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-1,3-benzothiazol-2-yl)ethanamine;hydrochloride?
The IUPAC name of 2-(5-chloro-1,3-benzothiazol-2-yl)ethanamine;hydrochloride (CID 71755889) is 2-(5-chloro-1,3-benzothiazol-2-yl)ethanamine;hydrochloride.
What is the SMILES notation for 2-(5-chloro-1,3-benzothiazol-2-yl)ethanamine;hydrochloride?
The canonical SMILES for 2-(5-chloro-1,3-benzothiazol-2-yl)ethanamine;hydrochloride is Cl.NCCc1nc2cc(Cl)ccc2s1.
What is the InChIKey of 2-(5-chloro-1,3-benzothiazol-2-yl)ethanamine;hydrochloride?
The InChIKey is JJPBWCIHXKXTKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN2S.ClH/c10-6-1-2-8-7(5-6)12-9(13-8)3-4-11;/h1-2,5H,3-4,11H2;1H.
What are the key properties of 2-(5-chloro-1,3-benzothiazol-2-yl)ethanamine;hydrochloride?
2-(5-chloro-1,3-benzothiazol-2-yl)ethanamine;hydrochloride has a molecular weight of 249.17 g/mol, XLogP of 2.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-1,3-benzothiazol-2-yl)ethanamine;hydrochloride is sourced from PubChem (CID 71755889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).