About 1,3-dimethyl-5,6-dihydro-4H-pyrazolo[5,4-b][1,4]oxazine
1,3-dimethyl-5,6-dihydro-4H-pyrazolo[5,4-b][1,4]oxazine (PubChem CID 71755951) has the molecular formula C7H11N3O
and a molecular weight of 153.19 g/mol. Its IUPAC name is 1,3-dimethyl-5,6-dihydro-4H-pyrazolo[5,4-b][1,4]oxazine.
Analyze 1,3-dimethyl-5,6-dihydro-4H-pyrazolo[5,4-b][1,4]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-5,6-dihydro-4H-pyrazolo[5,4-b][1,4]oxazine?
The IUPAC name of 1,3-dimethyl-5,6-dihydro-4H-pyrazolo[5,4-b][1,4]oxazine (CID 71755951) is 1,3-dimethyl-5,6-dihydro-4H-pyrazolo[5,4-b][1,4]oxazine.
What is the SMILES notation for 1,3-dimethyl-5,6-dihydro-4H-pyrazolo[5,4-b][1,4]oxazine?
The canonical SMILES for 1,3-dimethyl-5,6-dihydro-4H-pyrazolo[5,4-b][1,4]oxazine is Cc1nn(C)c2c1NCCO2.
What is the InChIKey of 1,3-dimethyl-5,6-dihydro-4H-pyrazolo[5,4-b][1,4]oxazine?
The InChIKey is RMRVJLDOZUHEHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O/c1-5-6-7(10(2)9-5)11-4-3-8-6/h8H,3-4H2,1-2H3.
What are the key properties of 1,3-dimethyl-5,6-dihydro-4H-pyrazolo[5,4-b][1,4]oxazine?
1,3-dimethyl-5,6-dihydro-4H-pyrazolo[5,4-b][1,4]oxazine has a molecular weight of 153.19 g/mol, XLogP of 0.53, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5,6-dihydro-4H-pyrazolo[5,4-b][1,4]oxazine is sourced from PubChem (CID 71755951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).