C11H14N2O2 — CID 71755958
7-amino-8-methoxy-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 71755958) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 7-amino-8-methoxy-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 7-amino-8-methoxy-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 71755958 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 7-amino-8-methoxy-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | COc1cc2c(cc1N)CCCC(=O)N2 |
| InChI | InChI=1S/C11H14N2O2/c1-15-10-6-9-7(5-8(10)12)3-2-4-11(14)13-9/h5-6H,2-4,12H2,1H3,(H,13,14) |
| InChIKey | OUSRKCLRMYOXBS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|