About 1-(2-imidazol-1-ylethyl)imidazolidine-2,4,5-trione;hydrochloride
1-(2-imidazol-1-ylethyl)imidazolidine-2,4,5-trione;hydrochloride (PubChem CID 71755995) has the molecular formula C8H9ClN4O3
and a molecular weight of 244.64 g/mol. Its IUPAC name is 1-(2-imidazol-1-ylethyl)imidazolidine-2,4,5-trione;hydrochloride.
Molecular Properties
| Compound Name | 1-(2-imidazol-1-ylethyl)imidazolidine-2,4,5-trione;hydrochloride |
| PubChem CID | 71755995 |
| Molecular Formula | C8H9ClN4O3 |
| Molecular Weight | 244.64 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 1-(2-imidazol-1-ylethyl)imidazolidine-2,4,5-trione;hydrochloride |
| SMILES | Cl.O=C1NC(=O)N(CCn2ccnc2)C1=O |
| InChI | InChI=1S/C8H8N4O3.ClH/c13-6-7(14)12(8(15)10-6)4-3-11-2-1-9-5-11;/h1-2,5H,3-4H2,(H,10,13,15);1H |
| InChIKey | ZYQNJARRAGFCBX-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.64 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-imidazol-1-ylethyl)imidazolidine-2,4,5-trione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-imidazol-1-ylethyl)imidazolidine-2,4,5-trione;hydrochloride?
The IUPAC name of 1-(2-imidazol-1-ylethyl)imidazolidine-2,4,5-trione;hydrochloride (CID 71755995) is 1-(2-imidazol-1-ylethyl)imidazolidine-2,4,5-trione;hydrochloride.
What is the SMILES notation for 1-(2-imidazol-1-ylethyl)imidazolidine-2,4,5-trione;hydrochloride?
The canonical SMILES for 1-(2-imidazol-1-ylethyl)imidazolidine-2,4,5-trione;hydrochloride is Cl.O=C1NC(=O)N(CCn2ccnc2)C1=O.
What is the InChIKey of 1-(2-imidazol-1-ylethyl)imidazolidine-2,4,5-trione;hydrochloride?
The InChIKey is ZYQNJARRAGFCBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O3.ClH/c13-6-7(14)12(8(15)10-6)4-3-11-2-1-9-5-11;/h1-2,5H,3-4H2,(H,10,13,15);1H.
What are the key properties of 1-(2-imidazol-1-ylethyl)imidazolidine-2,4,5-trione;hydrochloride?
1-(2-imidazol-1-ylethyl)imidazolidine-2,4,5-trione;hydrochloride has a molecular weight of 244.64 g/mol, XLogP of -0.62, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-imidazol-1-ylethyl)imidazolidine-2,4,5-trione;hydrochloride is sourced from PubChem (CID 71755995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).