About piperazin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone;hydrochloride
piperazin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone;hydrochloride (PubChem CID 71756201) has the molecular formula C11H13ClN2OS2
and a molecular weight of 288.82 g/mol. Its IUPAC name is piperazin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone;hydrochloride.
Molecular Properties
| Compound Name | piperazin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone;hydrochloride |
| PubChem CID | 71756201 |
| Molecular Formula | C11H13ClN2OS2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | piperazin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1cc2sccc2s1)N1CCNCC1 |
| InChI | InChI=1S/C11H12N2OS2.ClH/c14-11(13-4-2-12-3-5-13)10-7-9-8(16-10)1-6-15-9;/h1,6-7,12H,2-5H2;1H |
| InChIKey | DFKJHXHFZCTSRK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone;hydrochloride?
The IUPAC name of piperazin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone;hydrochloride (CID 71756201) is piperazin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone;hydrochloride.
What is the SMILES notation for piperazin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone;hydrochloride?
The canonical SMILES for piperazin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone;hydrochloride is Cl.O=C(c1cc2sccc2s1)N1CCNCC1.
What is the InChIKey of piperazin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone;hydrochloride?
The InChIKey is DFKJHXHFZCTSRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2OS2.ClH/c14-11(13-4-2-12-3-5-13)10-7-9-8(16-10)1-6-15-9;/h1,6-7,12H,2-5H2;1H.
What are the key properties of piperazin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone;hydrochloride?
piperazin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone;hydrochloride has a molecular weight of 288.82 g/mol, XLogP of 2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazin-1-yl(thieno[3,2-b]thiophen-5-yl)methanone;hydrochloride is sourced from PubChem (CID 71756201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).