About methyl 6-methyl-7-oxooctanoate
methyl 6-methyl-7-oxooctanoate (PubChem CID 71756279) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is methyl 6-methyl-7-oxooctanoate.
Molecular Properties
| Compound Name | methyl 6-methyl-7-oxooctanoate |
| PubChem CID | 71756279 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | methyl 6-methyl-7-oxooctanoate |
| SMILES | COC(=O)CCCCC(C)C(C)=O |
| InChI | InChI=1S/C10H18O3/c1-8(9(2)11)6-4-5-7-10(12)13-3/h8H,4-7H2,1-3H3 |
| InChIKey | JHXZNIABSDHLMR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-methyl-7-oxooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-methyl-7-oxooctanoate?
The IUPAC name of methyl 6-methyl-7-oxooctanoate (CID 71756279) is methyl 6-methyl-7-oxooctanoate.
What is the SMILES notation for methyl 6-methyl-7-oxooctanoate?
The canonical SMILES for methyl 6-methyl-7-oxooctanoate is COC(=O)CCCCC(C)C(C)=O.
What is the InChIKey of methyl 6-methyl-7-oxooctanoate?
The InChIKey is JHXZNIABSDHLMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-8(9(2)11)6-4-5-7-10(12)13-3/h8H,4-7H2,1-3H3.
What are the key properties of methyl 6-methyl-7-oxooctanoate?
methyl 6-methyl-7-oxooctanoate has a molecular weight of 186.25 g/mol, XLogP of 1.94, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methyl-7-oxooctanoate is sourced from PubChem (CID 71756279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).