About [1,2,4]triazolo[4,3-a]pyrazin-5-amine
[1,2,4]triazolo[4,3-a]pyrazin-5-amine (PubChem CID 71756308) has the molecular formula C5H5N5
and a molecular weight of 135.13 g/mol. Its IUPAC name is [1,2,4]triazolo[4,3-a]pyrazin-5-amine.
Molecular Properties
| Compound Name | [1,2,4]triazolo[4,3-a]pyrazin-5-amine |
| PubChem CID | 71756308 |
| Molecular Formula | C5H5N5 |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | [1,2,4]triazolo[4,3-a]pyrazin-5-amine |
| SMILES | Nc1cncc2nncn12 |
| InChI | InChI=1S/C5H5N5/c6-4-1-7-2-5-9-8-3-10(4)5/h1-3H,6H2 |
| InChIKey | ONDLFWRSGZXYFZ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1,2,4]triazolo[4,3-a]pyrazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2,4]triazolo[4,3-a]pyrazin-5-amine?
The IUPAC name of [1,2,4]triazolo[4,3-a]pyrazin-5-amine (CID 71756308) is [1,2,4]triazolo[4,3-a]pyrazin-5-amine.
What is the SMILES notation for [1,2,4]triazolo[4,3-a]pyrazin-5-amine?
The canonical SMILES for [1,2,4]triazolo[4,3-a]pyrazin-5-amine is Nc1cncc2nncn12.
What is the InChIKey of [1,2,4]triazolo[4,3-a]pyrazin-5-amine?
The InChIKey is ONDLFWRSGZXYFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5/c6-4-1-7-2-5-9-8-3-10(4)5/h1-3H,6H2.
What are the key properties of [1,2,4]triazolo[4,3-a]pyrazin-5-amine?
[1,2,4]triazolo[4,3-a]pyrazin-5-amine has a molecular weight of 135.13 g/mol, XLogP of -0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2,4]triazolo[4,3-a]pyrazin-5-amine is sourced from PubChem (CID 71756308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).