About 4-(aminomethyl)-3H-1,3-thiazol-2-one;hydrochloride
4-(aminomethyl)-3H-1,3-thiazol-2-one;hydrochloride (PubChem CID 71756373) has the molecular formula C4H7ClN2OS
and a molecular weight of 166.63 g/mol. Its IUPAC name is 4-(aminomethyl)-3H-1,3-thiazol-2-one;hydrochloride.
Molecular Properties
| Compound Name | 4-(aminomethyl)-3H-1,3-thiazol-2-one;hydrochloride |
| PubChem CID | 71756373 |
| Molecular Formula | C4H7ClN2OS |
| Molecular Weight | 166.63 g/mol |
| Exact Mass | 166.00 |
| IUPAC Name | 4-(aminomethyl)-3H-1,3-thiazol-2-one;hydrochloride |
| SMILES | Cl.NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C4H6N2OS.ClH/c5-1-3-2-8-4(7)6-3;/h2H,1,5H2,(H,6,7);1H |
| InChIKey | GESVTIZIQSIKIT-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.63 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(aminomethyl)-3H-1,3-thiazol-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-3H-1,3-thiazol-2-one;hydrochloride?
The IUPAC name of 4-(aminomethyl)-3H-1,3-thiazol-2-one;hydrochloride (CID 71756373) is 4-(aminomethyl)-3H-1,3-thiazol-2-one;hydrochloride.
What is the SMILES notation for 4-(aminomethyl)-3H-1,3-thiazol-2-one;hydrochloride?
The canonical SMILES for 4-(aminomethyl)-3H-1,3-thiazol-2-one;hydrochloride is Cl.NCc1csc(=O)[nH]1.
What is the InChIKey of 4-(aminomethyl)-3H-1,3-thiazol-2-one;hydrochloride?
The InChIKey is GESVTIZIQSIKIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2OS.ClH/c5-1-3-2-8-4(7)6-3;/h2H,1,5H2,(H,6,7);1H.
What are the key properties of 4-(aminomethyl)-3H-1,3-thiazol-2-one;hydrochloride?
4-(aminomethyl)-3H-1,3-thiazol-2-one;hydrochloride has a molecular weight of 166.63 g/mol, XLogP of 0.32, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-3H-1,3-thiazol-2-one;hydrochloride is sourced from PubChem (CID 71756373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).