About 2-imidazo[1,2-a]pyrimidin-2-ylethanamine;hydrobromide
2-imidazo[1,2-a]pyrimidin-2-ylethanamine;hydrobromide (PubChem CID 71756465) has the molecular formula C8H11BrN4
and a molecular weight of 243.11 g/mol. Its IUPAC name is 2-imidazo[1,2-a]pyrimidin-2-ylethanamine;hydrobromide.
Molecular Properties
| Compound Name | 2-imidazo[1,2-a]pyrimidin-2-ylethanamine;hydrobromide |
| PubChem CID | 71756465 |
| Molecular Formula | C8H11BrN4 |
| Molecular Weight | 243.11 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 2-imidazo[1,2-a]pyrimidin-2-ylethanamine;hydrobromide |
| SMILES | Br.NCCc1cn2cccnc2n1 |
| InChI | InChI=1S/C8H10N4.BrH/c9-3-2-7-6-12-5-1-4-10-8(12)11-7;/h1,4-6H,2-3,9H2;1H |
| InChIKey | UXTAXDTVWWNUSA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.11 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-imidazo[1,2-a]pyrimidin-2-ylethanamine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazo[1,2-a]pyrimidin-2-ylethanamine;hydrobromide?
The IUPAC name of 2-imidazo[1,2-a]pyrimidin-2-ylethanamine;hydrobromide (CID 71756465) is 2-imidazo[1,2-a]pyrimidin-2-ylethanamine;hydrobromide.
What is the SMILES notation for 2-imidazo[1,2-a]pyrimidin-2-ylethanamine;hydrobromide?
The canonical SMILES for 2-imidazo[1,2-a]pyrimidin-2-ylethanamine;hydrobromide is Br.NCCc1cn2cccnc2n1.
What is the InChIKey of 2-imidazo[1,2-a]pyrimidin-2-ylethanamine;hydrobromide?
The InChIKey is UXTAXDTVWWNUSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4.BrH/c9-3-2-7-6-12-5-1-4-10-8(12)11-7;/h1,4-6H,2-3,9H2;1H.
What are the key properties of 2-imidazo[1,2-a]pyrimidin-2-ylethanamine;hydrobromide?
2-imidazo[1,2-a]pyrimidin-2-ylethanamine;hydrobromide has a molecular weight of 243.11 g/mol, XLogP of 0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazo[1,2-a]pyrimidin-2-ylethanamine;hydrobromide is sourced from PubChem (CID 71756465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).