About N-(2,2-difluoroethyl)propan-2-amine;hydrochloride
N-(2,2-difluoroethyl)propan-2-amine;hydrochloride (PubChem CID 71756544) has the molecular formula C5H12ClF2N
and a molecular weight of 159.61 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)propan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)propan-2-amine;hydrochloride |
| PubChem CID | 71756544 |
| Molecular Formula | C5H12ClF2N |
| Molecular Weight | 159.61 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | N-(2,2-difluoroethyl)propan-2-amine;hydrochloride |
| SMILES | CC(C)NCC(F)F.Cl |
| InChI | InChI=1S/C5H11F2N.ClH/c1-4(2)8-3-5(6)7;/h4-5,8H,3H2,1-2H3;1H |
| InChIKey | PDHJTSOBSNCANC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.61 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2,2-difluoroethyl)propan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)propan-2-amine;hydrochloride?
The IUPAC name of N-(2,2-difluoroethyl)propan-2-amine;hydrochloride (CID 71756544) is N-(2,2-difluoroethyl)propan-2-amine;hydrochloride.
What is the SMILES notation for N-(2,2-difluoroethyl)propan-2-amine;hydrochloride?
The canonical SMILES for N-(2,2-difluoroethyl)propan-2-amine;hydrochloride is CC(C)NCC(F)F.Cl.
What is the InChIKey of N-(2,2-difluoroethyl)propan-2-amine;hydrochloride?
The InChIKey is PDHJTSOBSNCANC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11F2N.ClH/c1-4(2)8-3-5(6)7;/h4-5,8H,3H2,1-2H3;1H.
What are the key properties of N-(2,2-difluoroethyl)propan-2-amine;hydrochloride?
N-(2,2-difluoroethyl)propan-2-amine;hydrochloride has a molecular weight of 159.61 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)propan-2-amine;hydrochloride is sourced from PubChem (CID 71756544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).