About 5-(trifluoromethyl)-2,3-dihydro-1H-indole-6-carboxylic acid;hydrochloride
5-(trifluoromethyl)-2,3-dihydro-1H-indole-6-carboxylic acid;hydrochloride (PubChem CID 71756595) has the molecular formula C10H9ClF3NO2
and a molecular weight of 267.63 g/mol. Its IUPAC name is 5-(trifluoromethyl)-2,3-dihydro-1H-indole-6-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 5-(trifluoromethyl)-2,3-dihydro-1H-indole-6-carboxylic acid;hydrochloride |
| PubChem CID | 71756595 |
| Molecular Formula | C10H9ClF3NO2 |
| Molecular Weight | 267.63 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 5-(trifluoromethyl)-2,3-dihydro-1H-indole-6-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1cc2c(cc1C(F)(F)F)CCN2 |
| InChI | InChI=1S/C10H8F3NO2.ClH/c11-10(12,13)7-3-5-1-2-14-8(5)4-6(7)9(15)16;/h3-4,14H,1-2H2,(H,15,16);1H |
| InChIKey | KDEOEEYCPLTNGN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.63 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(trifluoromethyl)-2,3-dihydro-1H-indole-6-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(trifluoromethyl)-2,3-dihydro-1H-indole-6-carboxylic acid;hydrochloride?
The IUPAC name of 5-(trifluoromethyl)-2,3-dihydro-1H-indole-6-carboxylic acid;hydrochloride (CID 71756595) is 5-(trifluoromethyl)-2,3-dihydro-1H-indole-6-carboxylic acid;hydrochloride.
What is the SMILES notation for 5-(trifluoromethyl)-2,3-dihydro-1H-indole-6-carboxylic acid;hydrochloride?
The canonical SMILES for 5-(trifluoromethyl)-2,3-dihydro-1H-indole-6-carboxylic acid;hydrochloride is Cl.O=C(O)c1cc2c(cc1C(F)(F)F)CCN2.
What is the InChIKey of 5-(trifluoromethyl)-2,3-dihydro-1H-indole-6-carboxylic acid;hydrochloride?
The InChIKey is KDEOEEYCPLTNGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3NO2.ClH/c11-10(12,13)7-3-5-1-2-14-8(5)4-6(7)9(15)16;/h3-4,14H,1-2H2,(H,15,16);1H.
What are the key properties of 5-(trifluoromethyl)-2,3-dihydro-1H-indole-6-carboxylic acid;hydrochloride?
5-(trifluoromethyl)-2,3-dihydro-1H-indole-6-carboxylic acid;hydrochloride has a molecular weight of 267.63 g/mol, XLogP of 2.79, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(trifluoromethyl)-2,3-dihydro-1H-indole-6-carboxylic acid;hydrochloride is sourced from PubChem (CID 71756595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).