About N-(2-aminoethyl)-2,5-dimethylthiophene-3-sulfonamide;hydrochloride
N-(2-aminoethyl)-2,5-dimethylthiophene-3-sulfonamide;hydrochloride (PubChem CID 71756742) has the molecular formula C8H15ClN2O2S2
and a molecular weight of 270.81 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,5-dimethylthiophene-3-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-2,5-dimethylthiophene-3-sulfonamide;hydrochloride |
| PubChem CID | 71756742 |
| Molecular Formula | C8H15ClN2O2S2 |
| Molecular Weight | 270.81 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | N-(2-aminoethyl)-2,5-dimethylthiophene-3-sulfonamide;hydrochloride |
| SMILES | Cc1cc(S(=O)(=O)NCCN)c(C)s1.Cl |
| InChI | InChI=1S/C8H14N2O2S2.ClH/c1-6-5-8(7(2)13-6)14(11,12)10-4-3-9;/h5,10H,3-4,9H2,1-2H3;1H |
| InChIKey | LHMHQQWDRQYUDR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.81 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-aminoethyl)-2,5-dimethylthiophene-3-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-2,5-dimethylthiophene-3-sulfonamide;hydrochloride?
The IUPAC name of N-(2-aminoethyl)-2,5-dimethylthiophene-3-sulfonamide;hydrochloride (CID 71756742) is N-(2-aminoethyl)-2,5-dimethylthiophene-3-sulfonamide;hydrochloride.
What is the SMILES notation for N-(2-aminoethyl)-2,5-dimethylthiophene-3-sulfonamide;hydrochloride?
The canonical SMILES for N-(2-aminoethyl)-2,5-dimethylthiophene-3-sulfonamide;hydrochloride is Cc1cc(S(=O)(=O)NCCN)c(C)s1.Cl.
What is the InChIKey of N-(2-aminoethyl)-2,5-dimethylthiophene-3-sulfonamide;hydrochloride?
The InChIKey is LHMHQQWDRQYUDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2S2.ClH/c1-6-5-8(7(2)13-6)14(11,12)10-4-3-9;/h5,10H,3-4,9H2,1-2H3;1H.
What are the key properties of N-(2-aminoethyl)-2,5-dimethylthiophene-3-sulfonamide;hydrochloride?
N-(2-aminoethyl)-2,5-dimethylthiophene-3-sulfonamide;hydrochloride has a molecular weight of 270.81 g/mol, XLogP of 1.02, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-2,5-dimethylthiophene-3-sulfonamide;hydrochloride is sourced from PubChem (CID 71756742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).