About 6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-amine
6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-amine (PubChem CID 71756812) has the molecular formula C6H6ClN5
and a molecular weight of 183.60 g/mol. Its IUPAC name is 6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-amine.
Molecular Properties
| Compound Name | 6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-amine |
| PubChem CID | 71756812 |
| Molecular Formula | C6H6ClN5 |
| Molecular Weight | 183.60 g/mol |
| Exact Mass | 183.03 |
| IUPAC Name | 6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-amine |
| SMILES | Cc1nnc2c(N)cc(Cl)nn12 |
| InChI | InChI=1S/C6H6ClN5/c1-3-9-10-6-4(8)2-5(7)11-12(3)6/h2H,8H2,1H3 |
| InChIKey | DPQWAJPMHCHEBY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.60 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-amine?
The IUPAC name of 6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-amine (CID 71756812) is 6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-amine.
What is the SMILES notation for 6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-amine?
The canonical SMILES for 6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-amine is Cc1nnc2c(N)cc(Cl)nn12.
What is the InChIKey of 6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-amine?
The InChIKey is DPQWAJPMHCHEBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN5/c1-3-9-10-6-4(8)2-5(7)11-12(3)6/h2H,8H2,1H3.
What are the key properties of 6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-amine?
6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-amine has a molecular weight of 183.60 g/mol, XLogP of 0.67, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-amine is sourced from PubChem (CID 71756812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).