About 1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride
1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride (PubChem CID 71756835) has the molecular formula C8H10ClNO2S
and a molecular weight of 219.69 g/mol. Its IUPAC name is 1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride |
| PubChem CID | 71756835 |
| Molecular Formula | C8H10ClNO2S |
| Molecular Weight | 219.69 g/mol |
| Exact Mass | 219.01 |
| IUPAC Name | 1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride |
| SMILES | Cl.NC1CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C8H9NO2S.ClH/c9-7-5-12(10,11)8-4-2-1-3-6(7)8;/h1-4,7H,5,9H2;1H |
| InChIKey | JWGIERZTZOJHCI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.69 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride?
The IUPAC name of 1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride (CID 71756835) is 1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride.
What is the SMILES notation for 1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride?
The canonical SMILES for 1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride is Cl.NC1CS(=O)(=O)c2ccccc21.
What is the InChIKey of 1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride?
The InChIKey is JWGIERZTZOJHCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2S.ClH/c9-7-5-12(10,11)8-4-2-1-3-6(7)8;/h1-4,7H,5,9H2;1H.
What are the key properties of 1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride?
1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride has a molecular weight of 219.69 g/mol, XLogP of 0.90, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride is sourced from PubChem (CID 71756835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).